C17H25NS2 — CID 103345465
(4-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine (PubChem CID 103345465) has the molecular formula C17H25NS2 and a molecular weight of 307.53 g/mol. Its IUPAC name is (4-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine.
| Compound Name | (4-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 103345465 |
| Molecular Formula | C17H25NS2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (4-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine |
| SMILES | CC1SCC(C(N)c2ccc(C3CCC3)cc2)SC1C |
| InChI | InChI=1S/C17H25NS2/c1-11-12(2)20-16(10-19-11)17(18)15-8-6-14(7-9-15)13-4-3-5-13/h6-9,11-13,16-17H,3-5,10,18H2,1-2H3 |
| InChIKey | WWNMVKPEPQRCES-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |