C13H18ClNS2 — CID 103345442
(4-chlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine (PubChem CID 103345442) has the molecular formula C13H18ClNS2 and a molecular weight of 287.88 g/mol. Its IUPAC name is (4-chlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine.
| Compound Name | (4-chlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine |
|---|---|
| PubChem CID | 103345442 |
| Molecular Formula | C13H18ClNS2 |
| Molecular Weight | 287.88 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (4-chlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanamine |
| SMILES | CC1SCC(C(N)c2ccc(Cl)cc2)SC1C |
| InChI | InChI=1S/C13H18ClNS2/c1-8-9(2)17-12(7-16-8)13(15)10-3-5-11(14)6-4-10/h3-6,8-9,12-13H,7,15H2,1-2H3 |
| InChIKey | XVYIILJRNHXAQG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |