C14H19ClOS2 — CID 103345206
2-(4-chlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanol (PubChem CID 103345206) has the molecular formula C14H19ClOS2 and a molecular weight of 302.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(4-chlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 103345206 |
| Molecular Formula | C14H19ClOS2 |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanol |
| SMILES | CC1SCC(C(O)Cc2ccc(Cl)cc2)SC1C |
| InChI | InChI=1S/C14H19ClOS2/c1-9-10(2)18-14(8-17-9)13(16)7-11-3-5-12(15)6-4-11/h3-6,9-10,13-14,16H,7-8H2,1-2H3 |
| InChIKey | MXKXBSYOMDNFBO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |