C13H16Cl2OS2 — CID 103345266
(3,4-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol (PubChem CID 103345266) has the molecular formula C13H16Cl2OS2 and a molecular weight of 323.31 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 103345266 |
| Molecular Formula | C13H16Cl2OS2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | (3,4-dichlorophenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
| SMILES | CC1SCC(C(O)c2ccc(Cl)c(Cl)c2)SC1C |
| InChI | InChI=1S/C13H16Cl2OS2/c1-7-8(2)18-12(6-17-7)13(16)9-3-4-10(14)11(15)5-9/h3-5,7-8,12-13,16H,6H2,1-2H3 |
| InChIKey | YFJCCYGCEYQQOG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |