C17H24OS2 — CID 103345294
(3-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol (PubChem CID 103345294) has the molecular formula C17H24OS2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 103345294 |
| Molecular Formula | C17H24OS2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (3-cyclobutylphenyl)-(5,6-dimethyl-1,4-dithian-2-yl)methanol |
| SMILES | CC1SCC(C(O)c2cccc(C3CCC3)c2)SC1C |
| InChI | InChI=1S/C17H24OS2/c1-11-12(2)20-16(10-19-11)17(18)15-8-4-7-14(9-15)13-5-3-6-13/h4,7-9,11-13,16-18H,3,5-6,10H2,1-2H3 |
| InChIKey | DUWVDYZBPCKQTD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |