C19H20OS — CID 105132379
(3-cyclobutylphenyl)-(2,3-dihydro-1-benzothiophen-2-yl)methanol (PubChem CID 105132379) has the molecular formula C19H20OS and a molecular weight of 296.44 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(2,3-dihydro-1-benzothiophen-2-yl)methanol.
| Compound Name | (3-cyclobutylphenyl)-(2,3-dihydro-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 105132379 |
| Molecular Formula | C19H20OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (3-cyclobutylphenyl)-(2,3-dihydro-1-benzothiophen-2-yl)methanol |
| SMILES | OC(c1cccc(C2CCC2)c1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C19H20OS/c20-19(18-12-15-5-1-2-10-17(15)21-18)16-9-4-8-14(11-16)13-6-3-7-13/h1-2,4-5,8-11,13,18-20H,3,6-7,12H2 |
| InChIKey | ZVOUUHTZJLFDID-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |