C16H17NO2S — CID 105121436
2,3-dihydro-1-benzothiophen-2-yl-(5-ethoxy-3-pyridinyl)methanol (PubChem CID 105121436) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2,3-dihydro-1-benzothiophen-2-yl-(5-ethoxy-3-pyridinyl)methanol.
| Compound Name | 2,3-dihydro-1-benzothiophen-2-yl-(5-ethoxy-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 105121436 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2,3-dihydro-1-benzothiophen-2-yl-(5-ethoxy-3-pyridinyl)methanol |
| SMILES | CCOc1cncc(C(O)C2Cc3ccccc3S2)c1 |
| InChI | InChI=1S/C16H17NO2S/c1-2-19-13-7-12(9-17-10-13)16(18)15-8-11-5-3-4-6-14(11)20-15/h3-7,9-10,15-16,18H,2,8H2,1H3 |
| InChIKey | ULWLFRQFYHYUBT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |