C12H14O3 — CID 103351446
(8-ethoxy-2H-chromen-3-yl)methanol (PubChem CID 103351446) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (8-ethoxy-2H-chromen-3-yl)methanol.
| Compound Name | (8-ethoxy-2H-chromen-3-yl)methanol |
|---|---|
| PubChem CID | 103351446 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (8-ethoxy-2H-chromen-3-yl)methanol |
| SMILES | CCOc1cccc2c1OCC(CO)=C2 |
| InChI | InChI=1S/C12H14O3/c1-2-14-11-5-3-4-10-6-9(7-13)8-15-12(10)11/h3-6,13H,2,7-8H2,1H3 |
| InChIKey | FZXGOEAGFVRYGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |