C10H15ClN4O — CID 103353983
N-[(1-aminocyclobutyl)methyl]-5-chloro-2-methoxypyrimidin-4-amine (PubChem CID 103353983) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is N-[(1-aminocyclobutyl)methyl]-5-chloro-2-methoxypyrimidin-4-amine.
| Compound Name | N-[(1-aminocyclobutyl)methyl]-5-chloro-2-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 103353983 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[(1-aminocyclobutyl)methyl]-5-chloro-2-methoxypyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(NCC2(N)CCC2)n1 |
| InChI | InChI=1S/C10H15ClN4O/c1-16-9-13-5-7(11)8(15-9)14-6-10(12)3-2-4-10/h5H,2-4,6,12H2,1H3,(H,13,14,15) |
| InChIKey | MKLOJFVSRGZIFY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |