C9H15ClN4O — CID 80751988
1-N-(5-chloro-2-methoxypyrimidin-4-yl)butane-1,2-diamine (PubChem CID 80751988) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 1-N-(5-chloro-2-methoxypyrimidin-4-yl)butane-1,2-diamine.
| Compound Name | 1-N-(5-chloro-2-methoxypyrimidin-4-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 80751988 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-N-(5-chloro-2-methoxypyrimidin-4-yl)butane-1,2-diamine |
| SMILES | CCC(N)CNc1nc(OC)ncc1Cl |
| InChI | InChI=1S/C9H15ClN4O/c1-3-6(11)4-12-8-7(10)5-13-9(14-8)15-2/h5-6H,3-4,11H2,1-2H3,(H,12,13,14) |
| InChIKey | FMSAVFUZIVXQEG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |