C7H13BrN4O4S — CID 103354585
5-bromo-N-[2-(2-hydroxyethoxy)ethyl]-3-methyltriazole-4-sulfonamide (PubChem CID 103354585) has the molecular formula C7H13BrN4O4S and a molecular weight of 329.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]-3-methyltriazole-4-sulfonamide.
| Compound Name | 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]-3-methyltriazole-4-sulfonamide |
|---|---|
| PubChem CID | 103354585 |
| Molecular Formula | C7H13BrN4O4S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 5-bromo-N-[2-(2-hydroxyethoxy)ethyl]-3-methyltriazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NCCOCCO |
| InChI | InChI=1S/C7H13BrN4O4S/c1-12-7(6(8)10-11-12)17(14,15)9-2-4-16-5-3-13/h9,13H,2-5H2,1H3 |
| InChIKey | RCYKGZDTEJDOJR-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|