C7H11BrN4O3S — CID 103354692
5-bromo-3-methyl-N-(oxolan-3-yl)triazole-4-sulfonamide (PubChem CID 103354692) has the molecular formula C7H11BrN4O3S and a molecular weight of 311.16 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-(oxolan-3-yl)triazole-4-sulfonamide.
| Compound Name | 5-bromo-3-methyl-N-(oxolan-3-yl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 103354692 |
| Molecular Formula | C7H11BrN4O3S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 5-bromo-3-methyl-N-(oxolan-3-yl)triazole-4-sulfonamide |
| SMILES | Cn1nnc(Br)c1S(=O)(=O)NC1CCOC1 |
| InChI | InChI=1S/C7H11BrN4O3S/c1-12-7(6(8)9-11-12)16(13,14)10-5-2-3-15-4-5/h5,10H,2-4H2,1H3 |
| InChIKey | APKWAAHLCSTISY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |