About 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine
4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine (PubChem CID 103360444) has the molecular formula C10H17N3O2S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine |
| PubChem CID | 103360444 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine |
| SMILES | CCOc1c(N)nsc1N1CCOCC1C |
| InChI | InChI=1S/C10H17N3O2S/c1-3-15-8-9(11)12-16-10(8)13-4-5-14-6-7(13)2/h7H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | NSMVSIROHMWUBW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine?
The IUPAC name of 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine (CID 103360444) is 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine.
What is the SMILES notation for 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine?
The canonical SMILES for 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine is CCOc1c(N)nsc1N1CCOCC1C.
What is the InChIKey of 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine?
The InChIKey is NSMVSIROHMWUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2S/c1-3-15-8-9(11)12-16-10(8)13-4-5-14-6-7(13)2/h7H,3-6H2,1-2H3,(H2,11,12).
What are the key properties of 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine?
4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine has a molecular weight of 243.33 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-5-(3-methylmorpholin-4-yl)-1,2-thiazol-3-amine is sourced from PubChem (CID 103360444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).