C11H21N3S — CID 103360689
5-N,5-N-bis(2-methylpropyl)-1,2-thiazole-3,5-diamine (PubChem CID 103360689) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-N,5-N-bis(2-methylpropyl)-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N,5-N-bis(2-methylpropyl)-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103360689 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-N,5-N-bis(2-methylpropyl)-1,2-thiazole-3,5-diamine |
| SMILES | CC(C)CN(CC(C)C)c1cc(N)ns1 |
| InChI | InChI=1S/C11H21N3S/c1-8(2)6-14(7-9(3)4)11-5-10(12)13-15-11/h5,8-9H,6-7H2,1-4H3,(H2,12,13) |
| InChIKey | PKBOIHZTZDMMKT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |