C8H15N3S — CID 103362584
5-N-butan-2-yl-5-N-methyl-1,2-thiazole-3,5-diamine (PubChem CID 103362584) has the molecular formula C8H15N3S and a molecular weight of 185.30 g/mol. Its IUPAC name is 5-N-butan-2-yl-5-N-methyl-1,2-thiazole-3,5-diamine.
| Compound Name | 5-N-butan-2-yl-5-N-methyl-1,2-thiazole-3,5-diamine |
|---|---|
| PubChem CID | 103362584 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 5-N-butan-2-yl-5-N-methyl-1,2-thiazole-3,5-diamine |
| SMILES | CCC(C)N(C)c1cc(N)ns1 |
| InChI | InChI=1S/C8H15N3S/c1-4-6(2)11(3)8-5-7(9)10-12-8/h5-6H,4H2,1-3H3,(H2,9,10) |
| InChIKey | BFHHFLYVTDJJFT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |