C14H17N3O2S2 — CID 103361947
5-(1,3-dihydroisoindol-2-yl)-4-propylsulfonyl-1,2-thiazol-3-amine (PubChem CID 103361947) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-(1,3-dihydroisoindol-2-yl)-4-propylsulfonyl-1,2-thiazol-3-amine.
| Compound Name | 5-(1,3-dihydroisoindol-2-yl)-4-propylsulfonyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103361947 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-(1,3-dihydroisoindol-2-yl)-4-propylsulfonyl-1,2-thiazol-3-amine |
| SMILES | CCCS(=O)(=O)c1c(N)nsc1N1Cc2ccccc2C1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-2-7-21(18,19)12-13(15)16-20-14(12)17-8-10-5-3-4-6-11(10)9-17/h3-6H,2,7-9H2,1H3,(H2,15,16) |
| InChIKey | KJWMSPPIQHXDPT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |