C11H19N3O2S2 — CID 103362141
4-ethylsulfonyl-5-(3-methylpiperidin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103362141) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-(3-methylpiperidin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-ethylsulfonyl-5-(3-methylpiperidin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103362141 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-ethylsulfonyl-5-(3-methylpiperidin-1-yl)-1,2-thiazol-3-amine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1N1CCCC(C)C1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-3-18(15,16)9-10(12)13-17-11(9)14-6-4-5-8(2)7-14/h8H,3-7H2,1-2H3,(H2,12,13) |
| InChIKey | RDAXMNYNWCKHMY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |