C11H19N3O3S2 — CID 103365873
4-ethylsulfonyl-5-(3-methoxypiperidin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103365873) has the molecular formula C11H19N3O3S2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 4-ethylsulfonyl-5-(3-methoxypiperidin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-ethylsulfonyl-5-(3-methoxypiperidin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103365873 |
| Molecular Formula | C11H19N3O3S2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-ethylsulfonyl-5-(3-methoxypiperidin-1-yl)-1,2-thiazol-3-amine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1N1CCCC(OC)C1 |
| InChI | InChI=1S/C11H19N3O3S2/c1-3-19(15,16)9-10(12)13-18-11(9)14-6-4-5-8(7-14)17-2/h8H,3-7H2,1-2H3,(H2,12,13) |
| InChIKey | AVYOOSGYRORVTL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |