C13H21N3O2S2 — CID 103364823
5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-ethylsulfonyl-1,2-thiazol-3-amine (PubChem CID 103364823) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-ethylsulfonyl-1,2-thiazol-3-amine.
| Compound Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-ethylsulfonyl-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103364823 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-4-ethylsulfonyl-1,2-thiazol-3-amine |
| SMILES | CCS(=O)(=O)c1c(N)nsc1N1CCC2CCCCC21 |
| InChI | InChI=1S/C13H21N3O2S2/c1-2-20(17,18)11-12(14)15-19-13(11)16-8-7-9-5-3-4-6-10(9)16/h9-10H,2-8H2,1H3,(H2,14,15) |
| InChIKey | LOQUTISXWWDFLS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |