C9H12F3N3S — CID 103363237
5-[4-(trifluoromethyl)piperidin-1-yl]-1,2-thiazol-3-amine (PubChem CID 103363237) has the molecular formula C9H12F3N3S and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)piperidin-1-yl]-1,2-thiazol-3-amine.
| Compound Name | 5-[4-(trifluoromethyl)piperidin-1-yl]-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103363237 |
| Molecular Formula | C9H12F3N3S |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-[4-(trifluoromethyl)piperidin-1-yl]-1,2-thiazol-3-amine |
| SMILES | Nc1cc(N2CCC(C(F)(F)F)CC2)sn1 |
| InChI | InChI=1S/C9H12F3N3S/c10-9(11,12)6-1-3-15(4-2-6)8-5-7(13)14-16-8/h5-6H,1-4H2,(H2,13,14) |
| InChIKey | JZFYHYGPWCWCID-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |