C12H21N3S — CID 103363126
5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine (PubChem CID 103363126) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103363126 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine |
| SMILES | CCCC1CCCN(c2cc(N)ns2)CC1 |
| InChI | InChI=1S/C12H21N3S/c1-2-4-10-5-3-7-15(8-6-10)12-9-11(13)14-16-12/h9-10H,2-8H2,1H3,(H2,13,14) |
| InChIKey | BKTVNQCTTBEPFR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |