C15H27N3OS — CID 103363125
4-propan-2-yloxy-5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine (PubChem CID 103363125) has the molecular formula C15H27N3OS and a molecular weight of 297.47 g/mol. Its IUPAC name is 4-propan-2-yloxy-5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-propan-2-yloxy-5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103363125 |
| Molecular Formula | C15H27N3OS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-propan-2-yloxy-5-(4-propylazepan-1-yl)-1,2-thiazol-3-amine |
| SMILES | CCCC1CCCN(c2snc(N)c2OC(C)C)CC1 |
| InChI | InChI=1S/C15H27N3OS/c1-4-6-12-7-5-9-18(10-8-12)15-13(19-11(2)3)14(16)17-20-15/h11-12H,4-10H2,1-3H3,(H2,16,17) |
| InChIKey | OWJKBVOOGORXGG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |