C10H15F3N2O2 — CID 103366612
1-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 103366612) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 103366612 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[2-(aminomethyl)-3,3,3-trifluoropropyl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)CC(=O)N(CC(CN)C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H15F3N2O2/c1-9(2)3-7(16)15(8(9)17)5-6(4-14)10(11,12)13/h6H,3-5,14H2,1-2H3 |
| InChIKey | PZMRRBJIPFEZRE-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|