C8H13F3N2O2S2 — CID 103368549
2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368549) has the molecular formula C8H13F3N2O2S2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368549 |
| Molecular Formula | C8H13F3N2O2S2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(CN1CCS(=O)(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2S2/c9-8(10,11)6(7(12)16)5-13-1-3-17(14,15)4-2-13/h6H,1-5H2,(H2,12,16) |
| InChIKey | AHDJQPWGWLZEGS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|