C12H15F3N2S2 — CID 103368611
2-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368611) has the molecular formula C12H15F3N2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368611 |
| Molecular Formula | C12H15F3N2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[[cyclopropyl(thiophen-2-ylmethyl)amino]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(CN(Cc1cccs1)C1CC1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2S2/c13-12(14,15)10(11(16)18)7-17(8-3-4-8)6-9-2-1-5-19-9/h1-2,5,8,10H,3-4,6-7H2,(H2,16,18) |
| InChIKey | KXUYGITWUCPNBW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|