C16H18FNOS — CID 110885670
2-[cyclopropyl(thiophen-2-ylmethyl)amino]-1-(4-fluorophenyl)ethanol (PubChem CID 110885670) has the molecular formula C16H18FNOS and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 110885670 |
| Molecular Formula | C16H18FNOS |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]-1-(4-fluorophenyl)ethanol |
| SMILES | OC(CN(Cc1cccs1)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNOS/c17-13-5-3-12(4-6-13)16(19)11-18(14-7-8-14)10-15-2-1-9-20-15/h1-6,9,14,16,19H,7-8,10-11H2 |
| InChIKey | VKUFACJGAIWDLB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |