C17H18ClFN2O — CID 111565163
2-[(3-chloro-4-pyridinyl)methyl-cyclopropylamino]-1-(4-fluorophenyl)ethanol (PubChem CID 111565163) has the molecular formula C17H18ClFN2O and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-[(3-chloro-4-pyridinyl)methyl-cyclopropylamino]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[(3-chloro-4-pyridinyl)methyl-cyclopropylamino]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 111565163 |
| Molecular Formula | C17H18ClFN2O |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[(3-chloro-4-pyridinyl)methyl-cyclopropylamino]-1-(4-fluorophenyl)ethanol |
| SMILES | OC(CN(Cc1ccncc1Cl)C1CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18ClFN2O/c18-16-9-20-8-7-13(16)10-21(15-5-6-15)11-17(22)12-1-3-14(19)4-2-12/h1-4,7-9,15,17,22H,5-6,10-11H2 |
| InChIKey | YXBGWUJRVRRWFR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |