C10H18F3N3OS — CID 103368655
2-[(2-carbamothioyl-3,3,3-trifluoropropyl)-(2-methylpropyl)amino]acetamide (PubChem CID 103368655) has the molecular formula C10H18F3N3OS and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-[(2-carbamothioyl-3,3,3-trifluoropropyl)-(2-methylpropyl)amino]acetamide.
| Compound Name | 2-[(2-carbamothioyl-3,3,3-trifluoropropyl)-(2-methylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 103368655 |
| Molecular Formula | C10H18F3N3OS |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-[(2-carbamothioyl-3,3,3-trifluoropropyl)-(2-methylpropyl)amino]acetamide |
| SMILES | CC(C)CN(CC(N)=O)CC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3OS/c1-6(2)3-16(5-8(14)17)4-7(9(15)18)10(11,12)13/h6-7H,3-5H2,1-2H3,(H2,14,17)(H2,15,18) |
| InChIKey | ZJEFDUYKGIMPRZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|