C13H23F3N2S — CID 103368788
2-[[(4,4-dimethylcyclohexyl)-methylamino]methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368788) has the molecular formula C13H23F3N2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-[[(4,4-dimethylcyclohexyl)-methylamino]methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[[(4,4-dimethylcyclohexyl)-methylamino]methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368788 |
| Molecular Formula | C13H23F3N2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-[[(4,4-dimethylcyclohexyl)-methylamino]methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CN(CC(C(N)=S)C(F)(F)F)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23F3N2S/c1-12(2)6-4-9(5-7-12)18(3)8-10(11(17)19)13(14,15)16/h9-10H,4-8H2,1-3H3,(H2,17,19) |
| InChIKey | ZFBCELWCTUOUFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|