C7H14F3N5O2 — CID 103370109
2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethylurea (PubChem CID 103370109) has the molecular formula C7H14F3N5O2 and a molecular weight of 257.22 g/mol. Its IUPAC name is 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethylurea.
| Compound Name | 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethylurea |
|---|---|
| PubChem CID | 103370109 |
| Molecular Formula | C7H14F3N5O2 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethylurea |
| SMILES | NC(=O)NCCNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N5O2/c8-7(9,10)4(5(11)15-17)3-13-1-2-14-6(12)16/h4,13,17H,1-3H2,(H2,11,15)(H3,12,14,16) |
| InChIKey | OVWCTNZYOYXABW-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|