C9H18F3N5O2 — CID 103370108
1,1-dimethyl-3-[2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethyl]urea (PubChem CID 103370108) has the molecular formula C9H18F3N5O2 and a molecular weight of 285.27 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethyl]urea |
|---|---|
| PubChem CID | 103370108 |
| Molecular Formula | C9H18F3N5O2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1,1-dimethyl-3-[2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N5O2/c1-17(2)8(18)15-4-3-14-5-6(7(13)16-19)9(10,11)12/h6,14,19H,3-5H2,1-2H3,(H2,13,16)(H,15,18) |
| InChIKey | MMZAWXFNAZWORK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|