C9H17F3N4O2 — CID 104858941
1-(3-amino-3-hydroxyimino-2-methylpropyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea (PubChem CID 104858941) has the molecular formula C9H17F3N4O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyimino-2-methylpropyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-amino-3-hydroxyimino-2-methylpropyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 104858941 |
| Molecular Formula | C9H17F3N4O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(3-amino-3-hydroxyimino-2-methylpropyl)-1-ethyl-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCN(CC(C)C(N)=NO)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N4O2/c1-3-16(4-6(2)7(13)15-18)8(17)14-5-9(10,11)12/h6,18H,3-5H2,1-2H3,(H2,13,15)(H,14,17) |
| InChIKey | BGGYQDAUAJEOON-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|