C10H8F3NO2S — CID 103372411
2-(benzenesulfonylmethyl)-3,3,3-trifluoropropanenitrile (PubChem CID 103372411) has the molecular formula C10H8F3NO2S and a molecular weight of 263.24 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-(benzenesulfonylmethyl)-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103372411 |
| Molecular Formula | C10H8F3NO2S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-3,3,3-trifluoropropanenitrile |
| SMILES | N#CC(CS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2S/c11-10(12,13)8(6-14)7-17(15,16)9-4-2-1-3-5-9/h1-5,8H,7H2 |
| InChIKey | WNOFRRKLMYYIDE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |