C11H10F3NOS — CID 103372468
2-(benzylsulfinylmethyl)-3,3,3-trifluoropropanenitrile (PubChem CID 103372468) has the molecular formula C11H10F3NOS and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-(benzylsulfinylmethyl)-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-(benzylsulfinylmethyl)-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103372468 |
| Molecular Formula | C11H10F3NOS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-(benzylsulfinylmethyl)-3,3,3-trifluoropropanenitrile |
| SMILES | N#CC(CS(=O)Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H10F3NOS/c12-11(13,14)10(6-15)8-17(16)7-9-4-2-1-3-5-9/h1-5,10H,7-8H2 |
| InChIKey | NRELRDCYUSQPRV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |