C10H7F3N2O3S — CID 103372479
3,3,3-trifluoro-2-[(2-nitrophenyl)sulfinylmethyl]propanenitrile (PubChem CID 103372479) has the molecular formula C10H7F3N2O3S and a molecular weight of 292.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-nitrophenyl)sulfinylmethyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[(2-nitrophenyl)sulfinylmethyl]propanenitrile |
|---|---|
| PubChem CID | 103372479 |
| Molecular Formula | C10H7F3N2O3S |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-nitrophenyl)sulfinylmethyl]propanenitrile |
| SMILES | N#CC(CS(=O)c1ccccc1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C10H7F3N2O3S/c11-10(12,13)7(5-14)6-19(18)9-4-2-1-3-8(9)15(16)17/h1-4,7H,6H2 |
| InChIKey | WTUTZDXHTUGGCV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|