C10H10F4OS — CID 4178257
2,2,3,3-tetrafluoropropylsulfinylmethylbenzene (PubChem CID 4178257) has the molecular formula C10H10F4OS and a molecular weight of 254.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropylsulfinylmethylbenzene.
| Compound Name | 2,2,3,3-tetrafluoropropylsulfinylmethylbenzene |
|---|---|
| PubChem CID | 4178257 |
| Molecular Formula | C10H10F4OS |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2,2,3,3-tetrafluoropropylsulfinylmethylbenzene |
| SMILES | O=S(Cc1ccccc1)CC(F)(F)C(F)F |
| InChI | InChI=1S/C10H10F4OS/c11-9(12)10(13,14)7-16(15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | KIGMDIWZXANGKF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|