C8H16F3NO2S — CID 103372538
2-(butylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 103372538) has the molecular formula C8H16F3NO2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(butylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(butylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103372538 |
| Molecular Formula | C8H16F3NO2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(butylsulfonylmethyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | CCCCS(=O)(=O)CC(CN)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NO2S/c1-2-3-4-15(13,14)6-7(5-12)8(9,10)11/h7H,2-6,12H2,1H3 |
| InChIKey | BZHPJNIPCUJRDY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |