C11H16BrNO3 — CID 103376821
2-[2-amino-1-(5-bromo-2-methoxyphenyl)ethoxy]ethanol (PubChem CID 103376821) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[2-amino-1-(5-bromo-2-methoxyphenyl)ethoxy]ethanol.
| Compound Name | 2-[2-amino-1-(5-bromo-2-methoxyphenyl)ethoxy]ethanol |
|---|---|
| PubChem CID | 103376821 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[2-amino-1-(5-bromo-2-methoxyphenyl)ethoxy]ethanol |
| SMILES | COc1ccc(Br)cc1C(CN)OCCO |
| InChI | InChI=1S/C11H16BrNO3/c1-15-10-3-2-8(12)6-9(10)11(7-13)16-5-4-14/h2-3,6,11,14H,4-5,7,13H2,1H3 |
| InChIKey | YOLNSGMGPXQMRW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |