C14H21FO3 — CID 129227461
2-[(1S)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutoxy]ethanol (PubChem CID 129227461) has the molecular formula C14H21FO3 and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-[(1S)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutoxy]ethanol.
| Compound Name | 2-[(1S)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutoxy]ethanol |
|---|---|
| PubChem CID | 129227461 |
| Molecular Formula | C14H21FO3 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(1S)-1-(5-fluoro-2-methoxyphenyl)-3-methylbutoxy]ethanol |
| SMILES | COc1ccc(F)cc1[C@H](CC(C)C)OCCO |
| InChI | InChI=1S/C14H21FO3/c1-10(2)8-14(18-7-6-16)12-9-11(15)4-5-13(12)17-3/h4-5,9-10,14,16H,6-8H2,1-3H3/t14-/m0/s1 |
| InChIKey | CICXVLDDLMHYJF-AWEZNQCLSA-N |
| XLogP | 2.93 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |