C12H14FNO3 — CID 142550262
3-[1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]propanenitrile (PubChem CID 142550262) has the molecular formula C12H14FNO3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 3-[1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]propanenitrile.
| Compound Name | 3-[1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]propanenitrile |
|---|---|
| PubChem CID | 142550262 |
| Molecular Formula | C12H14FNO3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-[1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]propanenitrile |
| SMILES | COc1ccc(F)cc1C(CO)OCCC#N |
| InChI | InChI=1S/C12H14FNO3/c1-16-11-4-3-9(13)7-10(11)12(8-15)17-6-2-5-14/h3-4,7,12,15H,2,6,8H2,1H3 |
| InChIKey | SPOQHLFEVJKFTQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|