C16H21FO4 — CID 130433786
4-[[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]methyl]cyclohexan-1-one (PubChem CID 130433786) has the molecular formula C16H21FO4 and a molecular weight of 296.34 g/mol. Its IUPAC name is 4-[[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]methyl]cyclohexan-1-one.
| Compound Name | 4-[[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 130433786 |
| Molecular Formula | C16H21FO4 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 4-[[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]methyl]cyclohexan-1-one |
| SMILES | COc1ccc(F)cc1[C@H](CO)OCC1CCC(=O)CC1 |
| InChI | InChI=1S/C16H21FO4/c1-20-15-7-4-12(17)8-14(15)16(9-18)21-10-11-2-5-13(19)6-3-11/h4,7-8,11,16,18H,2-3,5-6,9-10H2,1H3/t16-/m0/s1 |
| InChIKey | CBRAGYKKHZTBDJ-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |