C18H25FO5 — CID 129176513
ethyl 4-[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]cyclohexane-1-carboxylate (PubChem CID 129176513) has the molecular formula C18H25FO5 and a molecular weight of 340.39 g/mol. Its IUPAC name is ethyl 4-[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 129176513 |
| Molecular Formula | C18H25FO5 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | ethyl 4-[(1R)-1-(5-fluoro-2-methoxyphenyl)-2-hydroxyethoxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O[C@@H](CO)c2cc(F)ccc2OC)CC1 |
| InChI | InChI=1S/C18H25FO5/c1-3-23-18(21)12-4-7-14(8-5-12)24-17(11-20)15-10-13(19)6-9-16(15)22-2/h6,9-10,12,14,17,20H,3-5,7-8,11H2,1-2H3/t12?,14?,17-/m0/s1 |
| InChIKey | RXYRALLHUFMXML-AJUCZRQESA-N |
| XLogP | 3.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |