C14H31NO2 — CID 103377208
3-[4-(aminomethyl)-2,6-dimethylheptan-4-yl]oxybutan-2-ol (PubChem CID 103377208) has the molecular formula C14H31NO2 and a molecular weight of 245.41 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-2,6-dimethylheptan-4-yl]oxybutan-2-ol.
| Compound Name | 3-[4-(aminomethyl)-2,6-dimethylheptan-4-yl]oxybutan-2-ol |
|---|---|
| PubChem CID | 103377208 |
| Molecular Formula | C14H31NO2 |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.24 |
| IUPAC Name | 3-[4-(aminomethyl)-2,6-dimethylheptan-4-yl]oxybutan-2-ol |
| SMILES | CC(C)CC(CN)(CC(C)C)OC(C)C(C)O |
| InChI | InChI=1S/C14H31NO2/c1-10(2)7-14(9-15,8-11(3)4)17-13(6)12(5)16/h10-13,16H,7-9,15H2,1-6H3 |
| InChIKey | AORDEILFIBIBKU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |