C8H14O6S — CID 103377644
3-(2-hydroxyethoxy)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 103377644) has the molecular formula C8H14O6S and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-(2-hydroxyethoxy)-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 3-(2-hydroxyethoxy)-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 103377644 |
| Molecular Formula | C8H14O6S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-(2-hydroxyethoxy)-1,1-dioxothiane-3-carboxylic acid |
| SMILES | O=C(O)C1(OCCO)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O6S/c9-3-4-14-8(7(10)11)2-1-5-15(12,13)6-8/h9H,1-6H2,(H,10,11) |
| InChIKey | CFRJNXIYESMANQ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |