2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid

C10H20O4 — CID 103377985

IUPAC2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid
SMILESCCC(C)C(C)(OCCCO)C(=O)O
InChIInChI=1S/C10H20O4/c1-4-8(2)10(3,9(12)13)14-7-5-6-11/h8,11H,4-7H2,1-3H3,(H,12,13)
InChIKeyMDYZVLVIIFJTDL-UHFFFAOYSA-N
MW204.27 g/mol
LogP1.27
Rot. Bonds7

About 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid

2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid (PubChem CID 103377985) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid.

Molecular Properties

Compound Name2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid
PubChem CID103377985
Molecular FormulaC10H20O4
Molecular Weight204.27 g/mol
Exact Mass204.14
IUPAC Name2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid
SMILESCCC(C)C(C)(OCCCO)C(=O)O
InChIInChI=1S/C10H20O4/c1-4-8(2)10(3,9(12)13)14-7-5-6-11/h8,11H,4-7H2,1-3H3,(H,12,13)
InChIKeyMDYZVLVIIFJTDL-UHFFFAOYSA-N
XLogP1.27
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.27
LogP ≤ 51.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid?
The IUPAC name of 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid (CID 103377985) is 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid.
What is the SMILES notation for 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid?
The canonical SMILES for 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid is CCC(C)C(C)(OCCCO)C(=O)O.
What is the InChIKey of 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid?
The InChIKey is MDYZVLVIIFJTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-4-8(2)10(3,9(12)13)14-7-5-6-11/h8,11H,4-7H2,1-3H3,(H,12,13).
What are the key properties of 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid?
2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid has a molecular weight of 204.27 g/mol, XLogP of 1.27, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxypropoxy)-2,3-dimethylpentanoic acid is sourced from PubChem (CID 103377985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).