About 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid
1-(3-hydroxypropoxy)propan-1-ol;propanoic acid (PubChem CID 71440134) has the molecular formula C9H20O5
and a molecular weight of 208.25 g/mol. Its IUPAC name is 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid.
Molecular Properties
| Compound Name | 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid |
| PubChem CID | 71440134 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid |
| SMILES | CCC(=O)O.CCC(O)OCCCO |
| InChI | InChI=1S/C6H14O3.C3H6O2/c1-2-6(8)9-5-3-4-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5) |
| InChIKey | PAZJRJIGNNZEEU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The IUPAC name of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid (CID 71440134) is 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid.
What is the SMILES notation for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The canonical SMILES for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid is CCC(=O)O.CCC(O)OCCCO.
What is the InChIKey of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The InChIKey is PAZJRJIGNNZEEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C3H6O2/c1-2-6(8)9-5-3-4-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
1-(3-hydroxypropoxy)propan-1-ol;propanoic acid has a molecular weight of 208.25 g/mol, XLogP of 0.59, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid is sourced from PubChem (CID 71440134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).