1-(3-hydroxypropoxy)propan-1-ol;propanoic acid

C9H20O5 — CID 71440134

IUPAC1-(3-hydroxypropoxy)propan-1-ol;propanoic acid
SMILESCCC(=O)O.CCC(O)OCCCO
InChIInChI=1S/C6H14O3.C3H6O2/c1-2-6(8)9-5-3-4-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5)
InChIKeyPAZJRJIGNNZEEU-UHFFFAOYSA-N
MW208.25 g/mol
LogP0.59
Rot. Bonds6

About 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid

1-(3-hydroxypropoxy)propan-1-ol;propanoic acid (PubChem CID 71440134) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid.

Molecular Properties

Compound Name1-(3-hydroxypropoxy)propan-1-ol;propanoic acid
PubChem CID71440134
Molecular FormulaC9H20O5
Molecular Weight208.25 g/mol
Exact Mass208.13
IUPAC Name1-(3-hydroxypropoxy)propan-1-ol;propanoic acid
SMILESCCC(=O)O.CCC(O)OCCCO
InChIInChI=1S/C6H14O3.C3H6O2/c1-2-6(8)9-5-3-4-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5)
InChIKeyPAZJRJIGNNZEEU-UHFFFAOYSA-N
XLogP0.59
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.25
LogP ≤ 50.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The IUPAC name of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid (CID 71440134) is 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid.
What is the SMILES notation for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The canonical SMILES for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid is CCC(=O)O.CCC(O)OCCCO.
What is the InChIKey of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
The InChIKey is PAZJRJIGNNZEEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3.C3H6O2/c1-2-6(8)9-5-3-4-7;1-2-3(4)5/h6-8H,2-5H2,1H3;2H2,1H3,(H,4,5).
What are the key properties of 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid?
1-(3-hydroxypropoxy)propan-1-ol;propanoic acid has a molecular weight of 208.25 g/mol, XLogP of 0.59, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxypropoxy)propan-1-ol;propanoic acid is sourced from PubChem (CID 71440134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).