C18H15N5OS — CID 10337887
1-[[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]quinoxalin-2-one (PubChem CID 10337887) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 1-[[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]quinoxalin-2-one.
| Compound Name | 1-[[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]quinoxalin-2-one |
|---|---|
| PubChem CID | 10337887 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-[[4-(2-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]quinoxalin-2-one |
| SMILES | Cc1ccccc1-n1c(Cn2c(=O)cnc3ccccc32)n[nH]c1=S |
| InChI | InChI=1S/C18H15N5OS/c1-12-6-2-4-8-14(12)23-16(20-21-18(23)25)11-22-15-9-5-3-7-13(15)19-10-17(22)24/h2-10H,11H2,1H3,(H,21,25) |
| InChIKey | SLOFNNUYMGZMSU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|