C14H20N3O2PS3 — CID 10810379
3-(diethoxyphosphinothioylsulfanylmethyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 10810379) has the molecular formula C14H20N3O2PS3 and a molecular weight of 389.51 g/mol. Its IUPAC name is 3-(diethoxyphosphinothioylsulfanylmethyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(diethoxyphosphinothioylsulfanylmethyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 10810379 |
| Molecular Formula | C14H20N3O2PS3 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-(diethoxyphosphinothioylsulfanylmethyl)-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOP(=S)(OCC)SCc1n[nH]c(=S)n1-c1ccccc1C |
| InChI | InChI=1S/C14H20N3O2PS3/c1-4-18-20(22,19-5-2)23-10-13-15-16-14(21)17(13)12-9-7-6-8-11(12)3/h6-9H,4-5,10H2,1-3H3,(H,16,21) |
| InChIKey | NWYOZLFOIVJIBK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|