C19H21N3O2S2 — CID 17375230
4-(2,4-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanylmethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 17375230) has the molecular formula C19H21N3O2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-(2,4-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanylmethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2,4-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanylmethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17375230 |
| Molecular Formula | C19H21N3O2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-(2,4-dimethoxyphenyl)-3-[(4-methylphenyl)methylsulfanylmethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(-n2c(CSCc3ccc(C)cc3)n[nH]c2=S)c(OC)c1 |
| InChI | InChI=1S/C19H21N3O2S2/c1-13-4-6-14(7-5-13)11-26-12-18-20-21-19(25)22(18)16-9-8-15(23-2)10-17(16)24-3/h4-10H,11-12H2,1-3H3,(H,21,25) |
| InChIKey | LBGMZOITLVNEPQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|