C14H17N3O3S — CID 103379213
methyl 3-amino-5-[2-(3-methylphenoxy)ethylamino]-1,2-thiazole-4-carboxylate (PubChem CID 103379213) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is methyl 3-amino-5-[2-(3-methylphenoxy)ethylamino]-1,2-thiazole-4-carboxylate.
| Compound Name | methyl 3-amino-5-[2-(3-methylphenoxy)ethylamino]-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 103379213 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 3-amino-5-[2-(3-methylphenoxy)ethylamino]-1,2-thiazole-4-carboxylate |
| SMILES | COC(=O)c1c(N)nsc1NCCOc1cccc(C)c1 |
| InChI | InChI=1S/C14H17N3O3S/c1-9-4-3-5-10(8-9)20-7-6-16-13-11(14(18)19-2)12(15)17-21-13/h3-5,8,16H,6-7H2,1-2H3,(H2,15,17) |
| InChIKey | XUQYDGMKQZNHKO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|